C17H15ClN4O3S — CID 9141132
(E)-3-(2-chloroimidazo[1,2-a]pyridin-3-yl)-N-(4-methyl-3-sulfamoylphenyl)prop-2-enamide (PubChem CID 9141132) has the molecular formula C17H15ClN4O3S and a molecular weight of 390.85 g/mol. Its IUPAC name is (E)-3-(2-chloroimidazo[1,2-a]pyridin-3-yl)-N-(4-methyl-3-sulfamoylphenyl)prop-2-enamide.
| Compound Name | (E)-3-(2-chloroimidazo[1,2-a]pyridin-3-yl)-N-(4-methyl-3-sulfamoylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 9141132 |
| Molecular Formula | C17H15ClN4O3S |
| Molecular Weight | 390.85 g/mol |
| Exact Mass | 390.06 |
| IUPAC Name | (E)-3-(2-chloroimidazo[1,2-a]pyridin-3-yl)-N-(4-methyl-3-sulfamoylphenyl)prop-2-enamide |
| SMILES | Cc1ccc(NC(=O)/C=C/c2c(Cl)nc3ccccn23)cc1S(N)(=O)=O |
| InChI | InChI=1S/C17H15ClN4O3S/c1-11-5-6-12(10-14(11)26(19,24)25)20-16(23)8-7-13-17(18)21-15-4-2-3-9-22(13)15/h2-10H,1H3,(H,20,23)(H2,19,24,25)/b8-7+ |
| InChIKey | UJFKHAWCGODADP-BQYQJAHWSA-N |
| XLogP | 2.60 |
| TPSA | 106.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.85 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|