C21H20ClN5O3S — CID 55967562
3-(2-chloroimidazo[1,2-a]pyridin-3-yl)-N-[4-[(1-methylpyrrolidin-2-ylidene)amino]sulfonylphenyl]prop-2-enamide (PubChem CID 55967562) has the molecular formula C21H20ClN5O3S and a molecular weight of 457.94 g/mol. Its IUPAC name is 3-(2-chloroimidazo[1,2-a]pyridin-3-yl)-N-[4-[(1-methylpyrrolidin-2-ylidene)amino]sulfonylphenyl]prop-2-enamide.
| Compound Name | 3-(2-chloroimidazo[1,2-a]pyridin-3-yl)-N-[4-[(1-methylpyrrolidin-2-ylidene)amino]sulfonylphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 55967562 |
| Molecular Formula | C21H20ClN5O3S |
| Molecular Weight | 457.94 g/mol |
| Exact Mass | 457.10 |
| IUPAC Name | 3-(2-chloroimidazo[1,2-a]pyridin-3-yl)-N-[4-[(1-methylpyrrolidin-2-ylidene)amino]sulfonylphenyl]prop-2-enamide |
| SMILES | CN1CCCC1=NS(=O)(=O)c1ccc(NC(=O)C=Cc2c(Cl)nc3ccccn23)cc1 |
| InChI | InChI=1S/C21H20ClN5O3S/c1-26-13-4-6-19(26)25-31(29,30)16-9-7-15(8-10-16)23-20(28)12-11-17-21(22)24-18-5-2-3-14-27(17)18/h2-3,5,7-12,14H,4,6,13H2,1H3,(H,23,28) |
| InChIKey | FOQWYJGXLZHKKQ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 96.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.94 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|