C19H15BrN2O2 — CID 46797124
(E)-3-(5-bromofuran-2-yl)-N-[phenyl(pyridin-2-yl)methyl]prop-2-enamide (PubChem CID 46797124) has the molecular formula C19H15BrN2O2 and a molecular weight of 383.25 g/mol. Its IUPAC name is (E)-3-(5-bromofuran-2-yl)-N-[phenyl(pyridin-2-yl)methyl]prop-2-enamide.
| Compound Name | (E)-3-(5-bromofuran-2-yl)-N-[phenyl(pyridin-2-yl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 46797124 |
| Molecular Formula | C19H15BrN2O2 |
| Molecular Weight | 383.25 g/mol |
| Exact Mass | 382.03 |
| IUPAC Name | (E)-3-(5-bromofuran-2-yl)-N-[phenyl(pyridin-2-yl)methyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(Br)o1)NC(c1ccccc1)c1ccccn1 |
| InChI | InChI=1S/C19H15BrN2O2/c20-17-11-9-15(24-17)10-12-18(23)22-19(14-6-2-1-3-7-14)16-8-4-5-13-21-16/h1-13,19H,(H,22,23)/b12-10+ |
| InChIKey | LCYDRIBPGYPOQL-ZRDIBKRKSA-N |
| XLogP | 4.36 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.25 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|