C18H20ClN3O4 — CID 129009140
3-[[(E)-3-(2-chloroimidazo[1,2-a]pyridin-3-yl)prop-2-enoyl]-(oxan-4-yl)amino]propanoic acid (PubChem CID 129009140) has the molecular formula C18H20ClN3O4 and a molecular weight of 377.83 g/mol. Its IUPAC name is 3-[[(E)-3-(2-chloroimidazo[1,2-a]pyridin-3-yl)prop-2-enoyl]-(oxan-4-yl)amino]propanoic acid.
| Compound Name | 3-[[(E)-3-(2-chloroimidazo[1,2-a]pyridin-3-yl)prop-2-enoyl]-(oxan-4-yl)amino]propanoic acid |
|---|---|
| PubChem CID | 129009140 |
| Molecular Formula | C18H20ClN3O4 |
| Molecular Weight | 377.83 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | 3-[[(E)-3-(2-chloroimidazo[1,2-a]pyridin-3-yl)prop-2-enoyl]-(oxan-4-yl)amino]propanoic acid |
| SMILES | O=C(O)CCN(C(=O)/C=C/c1c(Cl)nc2ccccn12)C1CCOCC1 |
| InChI | InChI=1S/C18H20ClN3O4/c19-18-14(22-9-2-1-3-15(22)20-18)4-5-16(23)21(10-6-17(24)25)13-7-11-26-12-8-13/h1-5,9,13H,6-8,10-12H2,(H,24,25)/b5-4+ |
| InChIKey | SWBYGKYRMTZTCV-SNAWJCMRSA-N |
| XLogP | 2.48 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.83 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|