C21H27ClN4O2 — CID 37259602
(E)-3-(2-chloroimidazo[1,2-a]pyridin-3-yl)-N-[(1-morpholin-4-ylcyclohexyl)methyl]prop-2-enamide (PubChem CID 37259602) has the molecular formula C21H27ClN4O2 and a molecular weight of 402.93 g/mol. Its IUPAC name is (E)-3-(2-chloroimidazo[1,2-a]pyridin-3-yl)-N-[(1-morpholin-4-ylcyclohexyl)methyl]prop-2-enamide.
| Compound Name | (E)-3-(2-chloroimidazo[1,2-a]pyridin-3-yl)-N-[(1-morpholin-4-ylcyclohexyl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 37259602 |
| Molecular Formula | C21H27ClN4O2 |
| Molecular Weight | 402.93 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | (E)-3-(2-chloroimidazo[1,2-a]pyridin-3-yl)-N-[(1-morpholin-4-ylcyclohexyl)methyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1c(Cl)nc2ccccn12)NCC1(N2CCOCC2)CCCCC1 |
| InChI | InChI=1S/C21H27ClN4O2/c22-20-17(26-11-5-2-6-18(26)24-20)7-8-19(27)23-16-21(9-3-1-4-10-21)25-12-14-28-15-13-25/h2,5-8,11H,1,3-4,9-10,12-16H2,(H,23,27)/b8-7+ |
| InChIKey | IKSBAHYHCCECFU-BQYQJAHWSA-N |
| XLogP | 3.15 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.93 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|