C20H27BrN2O2 — CID 37259528
(E)-3-(4-bromophenyl)-N-[(1-morpholin-4-ylcyclohexyl)methyl]prop-2-enamide (PubChem CID 37259528) has the molecular formula C20H27BrN2O2 and a molecular weight of 407.35 g/mol. Its IUPAC name is (E)-3-(4-bromophenyl)-N-[(1-morpholin-4-ylcyclohexyl)methyl]prop-2-enamide.
| Compound Name | (E)-3-(4-bromophenyl)-N-[(1-morpholin-4-ylcyclohexyl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 37259528 |
| Molecular Formula | C20H27BrN2O2 |
| Molecular Weight | 407.35 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | (E)-3-(4-bromophenyl)-N-[(1-morpholin-4-ylcyclohexyl)methyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(Br)cc1)NCC1(N2CCOCC2)CCCCC1 |
| InChI | InChI=1S/C20H27BrN2O2/c21-18-7-4-17(5-8-18)6-9-19(24)22-16-20(10-2-1-3-11-20)23-12-14-25-15-13-23/h4-9H,1-3,10-16H2,(H,22,24)/b9-6+ |
| InChIKey | KDJWZZWNKXNZOJ-RMKNXTFCSA-N |
| XLogP | 3.61 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.35 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|