C22H28BrFN2O4 — CID 46534991
[2-[(1-morpholin-4-ylcyclohexyl)methylamino]-2-oxoethyl] (E)-3-(5-bromo-2-fluorophenyl)prop-2-enoate (PubChem CID 46534991) has the molecular formula C22H28BrFN2O4 and a molecular weight of 483.38 g/mol. Its IUPAC name is [2-[(1-morpholin-4-ylcyclohexyl)methylamino]-2-oxoethyl] (E)-3-(5-bromo-2-fluorophenyl)prop-2-enoate.
| Compound Name | [2-[(1-morpholin-4-ylcyclohexyl)methylamino]-2-oxoethyl] (E)-3-(5-bromo-2-fluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 46534991 |
| Molecular Formula | C22H28BrFN2O4 |
| Molecular Weight | 483.38 g/mol |
| Exact Mass | 482.12 |
| IUPAC Name | [2-[(1-morpholin-4-ylcyclohexyl)methylamino]-2-oxoethyl] (E)-3-(5-bromo-2-fluorophenyl)prop-2-enoate |
| SMILES | O=C(COC(=O)/C=C/c1cc(Br)ccc1F)NCC1(N2CCOCC2)CCCCC1 |
| InChI | InChI=1S/C22H28BrFN2O4/c23-18-5-6-19(24)17(14-18)4-7-21(28)30-15-20(27)25-16-22(8-2-1-3-9-22)26-10-12-29-13-11-26/h4-7,14H,1-3,8-13,15-16H2,(H,25,27)/b7-4+ |
| InChIKey | GSXPEQTXFVWDNE-QPJJXVBHSA-N |
| XLogP | 3.30 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.38 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|