C25H35ClN2O6 — CID 55476142
[2-[(1-morpholin-4-ylcyclohexyl)methylamino]-2-oxoethyl] (E)-3-(3-chloro-5-ethoxy-4-methoxyphenyl)prop-2-enoate (PubChem CID 55476142) has the molecular formula C25H35ClN2O6 and a molecular weight of 495.02 g/mol. Its IUPAC name is [2-[(1-morpholin-4-ylcyclohexyl)methylamino]-2-oxoethyl] (E)-3-(3-chloro-5-ethoxy-4-methoxyphenyl)prop-2-enoate.
| Compound Name | [2-[(1-morpholin-4-ylcyclohexyl)methylamino]-2-oxoethyl] (E)-3-(3-chloro-5-ethoxy-4-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 55476142 |
| Molecular Formula | C25H35ClN2O6 |
| Molecular Weight | 495.02 g/mol |
| Exact Mass | 494.22 |
| IUPAC Name | [2-[(1-morpholin-4-ylcyclohexyl)methylamino]-2-oxoethyl] (E)-3-(3-chloro-5-ethoxy-4-methoxyphenyl)prop-2-enoate |
| SMILES | CCOc1cc(/C=C/C(=O)OCC(=O)NCC2(N3CCOCC3)CCCCC2)cc(Cl)c1OC |
| InChI | InChI=1S/C25H35ClN2O6/c1-3-33-21-16-19(15-20(26)24(21)31-2)7-8-23(30)34-17-22(29)27-18-25(9-5-4-6-10-25)28-11-13-32-14-12-28/h7-8,15-16H,3-6,9-14,17-18H2,1-2H3,(H,27,29)/b8-7+ |
| InChIKey | ZFVBPWVKWOQTIH-BQYQJAHWSA-N |
| XLogP | 3.45 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.02 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|