C20H23ClN2O5 — CID 7757654
[2-[(1-cyanocyclohexyl)amino]-2-oxoethyl] (E)-3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enoate (PubChem CID 7757654) has the molecular formula C20H23ClN2O5 and a molecular weight of 406.87 g/mol. Its IUPAC name is [2-[(1-cyanocyclohexyl)amino]-2-oxoethyl] (E)-3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enoate.
| Compound Name | [2-[(1-cyanocyclohexyl)amino]-2-oxoethyl] (E)-3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7757654 |
| Molecular Formula | C20H23ClN2O5 |
| Molecular Weight | 406.87 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | [2-[(1-cyanocyclohexyl)amino]-2-oxoethyl] (E)-3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enoate |
| SMILES | COc1cc(/C=C/C(=O)OCC(=O)NC2(C#N)CCCCC2)cc(Cl)c1OC |
| InChI | InChI=1S/C20H23ClN2O5/c1-26-16-11-14(10-15(21)19(16)27-2)6-7-18(25)28-12-17(24)23-20(13-22)8-4-3-5-9-20/h6-7,10-11H,3-5,8-9,12H2,1-2H3,(H,23,24)/b7-6+ |
| InChIKey | KRPRHNUDICIUAS-VOTSOKGWSA-N |
| XLogP | 3.26 |
| TPSA | 97.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.87 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|