C23H33ClN2O4 — CID 37259649
(E)-3-(3-chloro-4-ethoxy-5-methoxyphenyl)-N-[(1-morpholin-4-ylcyclohexyl)methyl]prop-2-enamide (PubChem CID 37259649) has the molecular formula C23H33ClN2O4 and a molecular weight of 436.98 g/mol. Its IUPAC name is (E)-3-(3-chloro-4-ethoxy-5-methoxyphenyl)-N-[(1-morpholin-4-ylcyclohexyl)methyl]prop-2-enamide.
| Compound Name | (E)-3-(3-chloro-4-ethoxy-5-methoxyphenyl)-N-[(1-morpholin-4-ylcyclohexyl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 37259649 |
| Molecular Formula | C23H33ClN2O4 |
| Molecular Weight | 436.98 g/mol |
| Exact Mass | 436.21 |
| IUPAC Name | (E)-3-(3-chloro-4-ethoxy-5-methoxyphenyl)-N-[(1-morpholin-4-ylcyclohexyl)methyl]prop-2-enamide |
| SMILES | CCOc1c(Cl)cc(/C=C/C(=O)NCC2(N3CCOCC3)CCCCC2)cc1OC |
| InChI | InChI=1S/C23H33ClN2O4/c1-3-30-22-19(24)15-18(16-20(22)28-2)7-8-21(27)25-17-23(9-5-4-6-10-23)26-11-13-29-14-12-26/h7-8,15-16H,3-6,9-14,17H2,1-2H3,(H,25,27)/b8-7+ |
| InChIKey | VLZCRXQZIUXRHO-BQYQJAHWSA-N |
| XLogP | 3.91 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.98 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|