C25H31ClN2O6 — CID 6155213
(E)-3-(3-chloro-4,5-dimethoxyphenyl)-N-(2,5-diethoxy-4-morpholin-4-ylphenyl)prop-2-enamide (PubChem CID 6155213) has the molecular formula C25H31ClN2O6 and a molecular weight of 490.98 g/mol. Its IUPAC name is (E)-3-(3-chloro-4,5-dimethoxyphenyl)-N-(2,5-diethoxy-4-morpholin-4-ylphenyl)prop-2-enamide.
| Compound Name | (E)-3-(3-chloro-4,5-dimethoxyphenyl)-N-(2,5-diethoxy-4-morpholin-4-ylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 6155213 |
| Molecular Formula | C25H31ClN2O6 |
| Molecular Weight | 490.98 g/mol |
| Exact Mass | 490.19 |
| IUPAC Name | (E)-3-(3-chloro-4,5-dimethoxyphenyl)-N-(2,5-diethoxy-4-morpholin-4-ylphenyl)prop-2-enamide |
| SMILES | CCOc1cc(N2CCOCC2)c(OCC)cc1NC(=O)/C=C/c1cc(Cl)c(OC)c(OC)c1 |
| InChI | InChI=1S/C25H31ClN2O6/c1-5-33-21-16-20(28-9-11-32-12-10-28)22(34-6-2)15-19(21)27-24(29)8-7-17-13-18(26)25(31-4)23(14-17)30-3/h7-8,13-16H,5-6,9-12H2,1-4H3,(H,27,29)/b8-7+ |
| InChIKey | PNRSHABIZTUKLR-BQYQJAHWSA-N |
| XLogP | 4.64 |
| TPSA | 78.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.98 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|