C20H22ClNO3 — CID 8714301
(E)-3-(3-chloro-5-ethoxy-4-methoxyphenyl)-N-(2,4-dimethylphenyl)prop-2-enamide (PubChem CID 8714301) has the molecular formula C20H22ClNO3 and a molecular weight of 359.85 g/mol. Its IUPAC name is (E)-3-(3-chloro-5-ethoxy-4-methoxyphenyl)-N-(2,4-dimethylphenyl)prop-2-enamide.
| Compound Name | (E)-3-(3-chloro-5-ethoxy-4-methoxyphenyl)-N-(2,4-dimethylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 8714301 |
| Molecular Formula | C20H22ClNO3 |
| Molecular Weight | 359.85 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | (E)-3-(3-chloro-5-ethoxy-4-methoxyphenyl)-N-(2,4-dimethylphenyl)prop-2-enamide |
| SMILES | CCOc1cc(/C=C/C(=O)Nc2ccc(C)cc2C)cc(Cl)c1OC |
| InChI | InChI=1S/C20H22ClNO3/c1-5-25-18-12-15(11-16(21)20(18)24-4)7-9-19(23)22-17-8-6-13(2)10-14(17)3/h6-12H,5H2,1-4H3,(H,22,23)/b9-7+ |
| InChIKey | WTSCBLFPEDBPRW-VQHVLOKHSA-N |
| XLogP | 5.02 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.85 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|