C18H18ClNO4 — CID 78783176
(E)-3-(3-chloro-5-ethoxy-4-methoxyphenyl)-N-(3-hydroxyphenyl)prop-2-enamide (PubChem CID 78783176) has the molecular formula C18H18ClNO4 and a molecular weight of 347.80 g/mol. Its IUPAC name is (E)-3-(3-chloro-5-ethoxy-4-methoxyphenyl)-N-(3-hydroxyphenyl)prop-2-enamide.
| Compound Name | (E)-3-(3-chloro-5-ethoxy-4-methoxyphenyl)-N-(3-hydroxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 78783176 |
| Molecular Formula | C18H18ClNO4 |
| Molecular Weight | 347.80 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | (E)-3-(3-chloro-5-ethoxy-4-methoxyphenyl)-N-(3-hydroxyphenyl)prop-2-enamide |
| SMILES | CCOc1cc(/C=C/C(=O)Nc2cccc(O)c2)cc(Cl)c1OC |
| InChI | InChI=1S/C18H18ClNO4/c1-3-24-16-10-12(9-15(19)18(16)23-2)7-8-17(22)20-13-5-4-6-14(21)11-13/h4-11,21H,3H2,1-2H3,(H,20,22)/b8-7+ |
| InChIKey | CYRSYZVLGCLUNS-BQYQJAHWSA-N |
| XLogP | 4.10 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.80 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|