C23H27N3O6 — CID 5190970
N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-3-(4-nitrophenyl)prop-2-enamide (PubChem CID 5190970) has the molecular formula C23H27N3O6 and a molecular weight of 441.48 g/mol. Its IUPAC name is N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-3-(4-nitrophenyl)prop-2-enamide.
| Compound Name | N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-3-(4-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 5190970 |
| Molecular Formula | C23H27N3O6 |
| Molecular Weight | 441.48 g/mol |
| Exact Mass | 441.19 |
| IUPAC Name | N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-3-(4-nitrophenyl)prop-2-enamide |
| SMILES | CCOc1cc(N2CCOCC2)c(OCC)cc1NC(=O)C=Cc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H27N3O6/c1-3-31-21-16-20(25-11-13-30-14-12-25)22(32-4-2)15-19(21)24-23(27)10-7-17-5-8-18(9-6-17)26(28)29/h5-10,15-16H,3-4,11-14H2,1-2H3,(H,24,27) |
| InChIKey | MKXLBKKEFXDGLZ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 103.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.48 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|