C23H27BrN2O4 — CID 26413911
(E)-3-(2-bromophenyl)-N-(2,5-diethoxy-4-morpholin-4-ylphenyl)prop-2-enamide (PubChem CID 26413911) has the molecular formula C23H27BrN2O4 and a molecular weight of 475.38 g/mol. Its IUPAC name is (E)-3-(2-bromophenyl)-N-(2,5-diethoxy-4-morpholin-4-ylphenyl)prop-2-enamide.
| Compound Name | (E)-3-(2-bromophenyl)-N-(2,5-diethoxy-4-morpholin-4-ylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 26413911 |
| Molecular Formula | C23H27BrN2O4 |
| Molecular Weight | 475.38 g/mol |
| Exact Mass | 474.12 |
| IUPAC Name | (E)-3-(2-bromophenyl)-N-(2,5-diethoxy-4-morpholin-4-ylphenyl)prop-2-enamide |
| SMILES | CCOc1cc(N2CCOCC2)c(OCC)cc1NC(=O)/C=C/c1ccccc1Br |
| InChI | InChI=1S/C23H27BrN2O4/c1-3-29-21-16-20(26-11-13-28-14-12-26)22(30-4-2)15-19(21)25-23(27)10-9-17-7-5-6-8-18(17)24/h5-10,15-16H,3-4,11-14H2,1-2H3,(H,25,27)/b10-9+ |
| InChIKey | AHIKILLSHDYTAN-MDZDMXLPSA-N |
| XLogP | 4.74 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.38 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|