C30H38N4O4 — CID 4655750
N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-3-[3,5-dimethyl-1-[(4-methylphenyl)methyl]pyrazol-4-yl]prop-2-enamide (PubChem CID 4655750) has the molecular formula C30H38N4O4 and a molecular weight of 518.66 g/mol. Its IUPAC name is N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-3-[3,5-dimethyl-1-[(4-methylphenyl)methyl]pyrazol-4-yl]prop-2-enamide.
| Compound Name | N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-3-[3,5-dimethyl-1-[(4-methylphenyl)methyl]pyrazol-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 4655750 |
| Molecular Formula | C30H38N4O4 |
| Molecular Weight | 518.66 g/mol |
| Exact Mass | 518.29 |
| IUPAC Name | N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-3-[3,5-dimethyl-1-[(4-methylphenyl)methyl]pyrazol-4-yl]prop-2-enamide |
| SMILES | CCOc1cc(N2CCOCC2)c(OCC)cc1NC(=O)C=Cc1c(C)nn(Cc2ccc(C)cc2)c1C |
| InChI | InChI=1S/C30H38N4O4/c1-6-37-28-19-27(33-14-16-36-17-15-33)29(38-7-2)18-26(28)31-30(35)13-12-25-22(4)32-34(23(25)5)20-24-10-8-21(3)9-11-24/h8-13,18-19H,6-7,14-17,20H2,1-5H3,(H,31,35) |
| InChIKey | JFWPEFCBYGQZRZ-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 77.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.66 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|