C22H22IN3O — CID 26274134
(E)-3-[3,5-dimethyl-1-[(4-methylphenyl)methyl]pyrazol-4-yl]-N-(2-iodophenyl)prop-2-enamide (PubChem CID 26274134) has the molecular formula C22H22IN3O and a molecular weight of 471.34 g/mol. Its IUPAC name is (E)-3-[3,5-dimethyl-1-[(4-methylphenyl)methyl]pyrazol-4-yl]-N-(2-iodophenyl)prop-2-enamide.
| Compound Name | (E)-3-[3,5-dimethyl-1-[(4-methylphenyl)methyl]pyrazol-4-yl]-N-(2-iodophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 26274134 |
| Molecular Formula | C22H22IN3O |
| Molecular Weight | 471.34 g/mol |
| Exact Mass | 471.08 |
| IUPAC Name | (E)-3-[3,5-dimethyl-1-[(4-methylphenyl)methyl]pyrazol-4-yl]-N-(2-iodophenyl)prop-2-enamide |
| SMILES | Cc1ccc(Cn2nc(C)c(/C=C/C(=O)Nc3ccccc3I)c2C)cc1 |
| InChI | InChI=1S/C22H22IN3O/c1-15-8-10-18(11-9-15)14-26-17(3)19(16(2)25-26)12-13-22(27)24-21-7-5-4-6-20(21)23/h4-13H,14H2,1-3H3,(H,24,27)/b13-12+ |
| InChIKey | HYCAVLATYCRXRF-OUKQBFOZSA-N |
| XLogP | 5.11 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.34 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|