C29H26N4O — CID 25410622
(E)-3-[3,5-dimethyl-1-[(4-methylphenyl)methyl]pyrazol-4-yl]-N-[3-(2-pyridin-2-ylethynyl)phenyl]prop-2-enamide (PubChem CID 25410622) has the molecular formula C29H26N4O and a molecular weight of 446.55 g/mol. Its IUPAC name is (E)-3-[3,5-dimethyl-1-[(4-methylphenyl)methyl]pyrazol-4-yl]-N-[3-(2-pyridin-2-ylethynyl)phenyl]prop-2-enamide.
| Compound Name | (E)-3-[3,5-dimethyl-1-[(4-methylphenyl)methyl]pyrazol-4-yl]-N-[3-(2-pyridin-2-ylethynyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 25410622 |
| Molecular Formula | C29H26N4O |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.21 |
| IUPAC Name | (E)-3-[3,5-dimethyl-1-[(4-methylphenyl)methyl]pyrazol-4-yl]-N-[3-(2-pyridin-2-ylethynyl)phenyl]prop-2-enamide |
| SMILES | Cc1ccc(Cn2nc(C)c(/C=C/C(=O)Nc3cccc(C#Cc4ccccn4)c3)c2C)cc1 |
| InChI | InChI=1S/C29H26N4O/c1-21-10-12-25(13-11-21)20-33-23(3)28(22(2)32-33)16-17-29(34)31-27-9-6-7-24(19-27)14-15-26-8-4-5-18-30-26/h4-13,16-19H,20H2,1-3H3,(H,31,34)/b17-16+ |
| InChIKey | GVYNRAFBMAYTBR-WUKNDPDISA-N |
| XLogP | 5.30 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|