C23H21ClN4O — CID 27163435
(E)-3-[1-[(2-chlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-N-[4-(cyanomethyl)phenyl]prop-2-enamide (PubChem CID 27163435) has the molecular formula C23H21ClN4O and a molecular weight of 404.90 g/mol. Its IUPAC name is (E)-3-[1-[(2-chlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-N-[4-(cyanomethyl)phenyl]prop-2-enamide.
| Compound Name | (E)-3-[1-[(2-chlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-N-[4-(cyanomethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 27163435 |
| Molecular Formula | C23H21ClN4O |
| Molecular Weight | 404.90 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | (E)-3-[1-[(2-chlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-N-[4-(cyanomethyl)phenyl]prop-2-enamide |
| SMILES | Cc1nn(Cc2ccccc2Cl)c(C)c1/C=C/C(=O)Nc1ccc(CC#N)cc1 |
| InChI | InChI=1S/C23H21ClN4O/c1-16-21(17(2)28(27-16)15-19-5-3-4-6-22(19)24)11-12-23(29)26-20-9-7-18(8-10-20)13-14-25/h3-12H,13,15H2,1-2H3,(H,26,29)/b12-11+ |
| InChIKey | MCYDFBNBVMRFHG-VAWYXSNFSA-N |
| XLogP | 4.92 |
| TPSA | 70.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.90 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|