C24H33ClN4O2 — CID 134024205
(E)-3-[1-[(2-chlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-N-[3-(2,6-dimethylmorpholin-4-yl)propyl]prop-2-enamide (PubChem CID 134024205) has the molecular formula C24H33ClN4O2 and a molecular weight of 445.01 g/mol. Its IUPAC name is (E)-3-[1-[(2-chlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-N-[3-(2,6-dimethylmorpholin-4-yl)propyl]prop-2-enamide.
| Compound Name | (E)-3-[1-[(2-chlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-N-[3-(2,6-dimethylmorpholin-4-yl)propyl]prop-2-enamide |
|---|---|
| PubChem CID | 134024205 |
| Molecular Formula | C24H33ClN4O2 |
| Molecular Weight | 445.01 g/mol |
| Exact Mass | 444.23 |
| IUPAC Name | (E)-3-[1-[(2-chlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-N-[3-(2,6-dimethylmorpholin-4-yl)propyl]prop-2-enamide |
| SMILES | Cc1nn(Cc2ccccc2Cl)c(C)c1/C=C/C(=O)NCCCN1CC(C)OC(C)C1 |
| InChI | InChI=1S/C24H33ClN4O2/c1-17-14-28(15-18(2)31-17)13-7-12-26-24(30)11-10-22-19(3)27-29(20(22)4)16-21-8-5-6-9-23(21)25/h5-6,8-11,17-18H,7,12-16H2,1-4H3,(H,26,30)/b11-10+ |
| InChIKey | BSPSQJILURVUNI-ZHACJKMWSA-N |
| XLogP | 3.83 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.01 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|