C16H18ClN3O — CID 26692075
(E)-N-[(2-chlorophenyl)methyl]-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-enamide (PubChem CID 26692075) has the molecular formula C16H18ClN3O and a molecular weight of 303.79 g/mol. Its IUPAC name is (E)-N-[(2-chlorophenyl)methyl]-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-enamide.
| Compound Name | (E)-N-[(2-chlorophenyl)methyl]-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 26692075 |
| Molecular Formula | C16H18ClN3O |
| Molecular Weight | 303.79 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | (E)-N-[(2-chlorophenyl)methyl]-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-enamide |
| SMILES | Cc1nn(C)c(C)c1/C=C/C(=O)NCc1ccccc1Cl |
| InChI | InChI=1S/C16H18ClN3O/c1-11-14(12(2)20(3)19-11)8-9-16(21)18-10-13-6-4-5-7-15(13)17/h4-9H,10H2,1-3H3,(H,18,21)/b9-8+ |
| InChIKey | YZGOTIDAIGTTID-CMDGGOBGSA-N |
| XLogP | 3.02 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.79 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|