C22H19ClN2O3 — CID 8858500
(E)-1-(1,3-benzodioxol-5-yl)-3-[1-[(2-chlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]prop-2-en-1-one (PubChem CID 8858500) has the molecular formula C22H19ClN2O3 and a molecular weight of 394.86 g/mol. Its IUPAC name is (E)-1-(1,3-benzodioxol-5-yl)-3-[1-[(2-chlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]prop-2-en-1-one.
| Compound Name | (E)-1-(1,3-benzodioxol-5-yl)-3-[1-[(2-chlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 8858500 |
| Molecular Formula | C22H19ClN2O3 |
| Molecular Weight | 394.86 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | (E)-1-(1,3-benzodioxol-5-yl)-3-[1-[(2-chlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]prop-2-en-1-one |
| SMILES | Cc1nn(Cc2ccccc2Cl)c(C)c1/C=C/C(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C22H19ClN2O3/c1-14-18(15(2)25(24-14)12-17-5-3-4-6-19(17)23)8-9-20(26)16-7-10-21-22(11-16)28-13-27-21/h3-11H,12-13H2,1-2H3/b9-8+ |
| InChIKey | QFOXLRCVHLOATG-CMDGGOBGSA-N |
| XLogP | 4.83 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.86 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|