C24H34ClN5O — CID 78876343
3-[1-[(2-chlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-N-[2-(4-ethylpiperazin-1-yl)propyl]prop-2-enamide (PubChem CID 78876343) has the molecular formula C24H34ClN5O and a molecular weight of 444.02 g/mol. Its IUPAC name is 3-[1-[(2-chlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-N-[2-(4-ethylpiperazin-1-yl)propyl]prop-2-enamide.
| Compound Name | 3-[1-[(2-chlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-N-[2-(4-ethylpiperazin-1-yl)propyl]prop-2-enamide |
|---|---|
| PubChem CID | 78876343 |
| Molecular Formula | C24H34ClN5O |
| Molecular Weight | 444.02 g/mol |
| Exact Mass | 443.25 |
| IUPAC Name | 3-[1-[(2-chlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-N-[2-(4-ethylpiperazin-1-yl)propyl]prop-2-enamide |
| SMILES | CCN1CCN(C(C)CNC(=O)C=Cc2c(C)nn(Cc3ccccc3Cl)c2C)CC1 |
| InChI | InChI=1S/C24H34ClN5O/c1-5-28-12-14-29(15-13-28)18(2)16-26-24(31)11-10-22-19(3)27-30(20(22)4)17-21-8-6-7-9-23(21)25/h6-11,18H,5,12-17H2,1-4H3,(H,26,31) |
| InChIKey | RFAYPOWCZURVAT-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.02 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|