C22H28ClN3O3 — CID 55428260
methyl 2-[[(E)-3-[1-[(2-chlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]prop-2-enoyl]amino]-4-methylpentanoate (PubChem CID 55428260) has the molecular formula C22H28ClN3O3 and a molecular weight of 417.94 g/mol. Its IUPAC name is methyl 2-[[(E)-3-[1-[(2-chlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]prop-2-enoyl]amino]-4-methylpentanoate.
| Compound Name | methyl 2-[[(E)-3-[1-[(2-chlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]prop-2-enoyl]amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 55428260 |
| Molecular Formula | C22H28ClN3O3 |
| Molecular Weight | 417.94 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | methyl 2-[[(E)-3-[1-[(2-chlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]prop-2-enoyl]amino]-4-methylpentanoate |
| SMILES | COC(=O)C(CC(C)C)NC(=O)/C=C/c1c(C)nn(Cc2ccccc2Cl)c1C |
| InChI | InChI=1S/C22H28ClN3O3/c1-14(2)12-20(22(28)29-5)24-21(27)11-10-18-15(3)25-26(16(18)4)13-17-8-6-7-9-19(17)23/h6-11,14,20H,12-13H2,1-5H3,(H,24,27)/b11-10+ |
| InChIKey | UDFQKFPYRPRXGD-ZHACJKMWSA-N |
| XLogP | 3.92 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.94 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|