C20H23ClN4O — CID 40674443
(E)-N-butyl-3-[1-[(2-chlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-2-cyanoprop-2-enamide (PubChem CID 40674443) has the molecular formula C20H23ClN4O and a molecular weight of 370.88 g/mol. Its IUPAC name is (E)-N-butyl-3-[1-[(2-chlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-2-cyanoprop-2-enamide.
| Compound Name | (E)-N-butyl-3-[1-[(2-chlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 40674443 |
| Molecular Formula | C20H23ClN4O |
| Molecular Weight | 370.88 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | (E)-N-butyl-3-[1-[(2-chlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-2-cyanoprop-2-enamide |
| SMILES | CCCCNC(=O)/C(C#N)=C/c1c(C)nn(Cc2ccccc2Cl)c1C |
| InChI | InChI=1S/C20H23ClN4O/c1-4-5-10-23-20(26)17(12-22)11-18-14(2)24-25(15(18)3)13-16-8-6-7-9-19(16)21/h6-9,11H,4-5,10,13H2,1-3H3,(H,23,26)/b17-11+ |
| InChIKey | NFJTVWMCLPOYDW-GZTJUZNOSA-N |
| XLogP | 4.02 |
| TPSA | 70.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.88 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|