C13H12ClN2O2- — CID 2451343
1-[(2-chlorophenyl)methyl]-3,5-dimethylpyrazole-4-carboxylate (PubChem CID 2451343) has the molecular formula C13H12ClN2O2- and a molecular weight of 263.70 g/mol. Its IUPAC name is 1-[(2-chlorophenyl)methyl]-3,5-dimethylpyrazole-4-carboxylate.
| Compound Name | 1-[(2-chlorophenyl)methyl]-3,5-dimethylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 2451343 |
| Molecular Formula | C13H12ClN2O2- |
| Molecular Weight | 263.70 g/mol |
| Exact Mass | 263.06 |
| IUPAC Name | 1-[(2-chlorophenyl)methyl]-3,5-dimethylpyrazole-4-carboxylate |
| SMILES | Cc1nn(Cc2ccccc2Cl)c(C)c1C(=O)[O-] |
| InChI | InChI=1S/C13H13ClN2O2/c1-8-12(13(17)18)9(2)16(15-8)7-10-5-3-4-6-11(10)14/h3-6H,7H2,1-2H3,(H,17,18)/p-1 |
| InChIKey | QSWSBGHWRLNFEZ-UHFFFAOYSA-M |
| XLogP | 1.57 |
| TPSA | 57.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.70 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |