C19H16Cl4N4O — CID 29204279
1-[(2-chlorophenyl)methyl]-3,5-dimethyl-N'-(2,4,6-trichlorophenyl)pyrazole-4-carbohydrazide (PubChem CID 29204279) has the molecular formula C19H16Cl4N4O and a molecular weight of 458.18 g/mol. Its IUPAC name is 1-[(2-chlorophenyl)methyl]-3,5-dimethyl-N'-(2,4,6-trichlorophenyl)pyrazole-4-carbohydrazide.
| Compound Name | 1-[(2-chlorophenyl)methyl]-3,5-dimethyl-N'-(2,4,6-trichlorophenyl)pyrazole-4-carbohydrazide |
|---|---|
| PubChem CID | 29204279 |
| Molecular Formula | C19H16Cl4N4O |
| Molecular Weight | 458.18 g/mol |
| Exact Mass | 456.01 |
| IUPAC Name | 1-[(2-chlorophenyl)methyl]-3,5-dimethyl-N'-(2,4,6-trichlorophenyl)pyrazole-4-carbohydrazide |
| SMILES | Cc1nn(Cc2ccccc2Cl)c(C)c1C(=O)NNc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C19H16Cl4N4O/c1-10-17(11(2)27(26-10)9-12-5-3-4-6-14(12)21)19(28)25-24-18-15(22)7-13(20)8-16(18)23/h3-8,24H,9H2,1-2H3,(H,25,28) |
| InChIKey | LYESRQDLXGQCFE-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.18 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|