C18H16Cl2N4O — CID 78774668
5-chloro-1-[(2-chlorophenyl)methyl]-3-methyl-N'-phenylpyrazole-4-carbohydrazide (PubChem CID 78774668) has the molecular formula C18H16Cl2N4O and a molecular weight of 375.26 g/mol. Its IUPAC name is 5-chloro-1-[(2-chlorophenyl)methyl]-3-methyl-N'-phenylpyrazole-4-carbohydrazide.
| Compound Name | 5-chloro-1-[(2-chlorophenyl)methyl]-3-methyl-N'-phenylpyrazole-4-carbohydrazide |
|---|---|
| PubChem CID | 78774668 |
| Molecular Formula | C18H16Cl2N4O |
| Molecular Weight | 375.26 g/mol |
| Exact Mass | 374.07 |
| IUPAC Name | 5-chloro-1-[(2-chlorophenyl)methyl]-3-methyl-N'-phenylpyrazole-4-carbohydrazide |
| SMILES | Cc1nn(Cc2ccccc2Cl)c(Cl)c1C(=O)NNc1ccccc1 |
| InChI | InChI=1S/C18H16Cl2N4O/c1-12-16(18(25)22-21-14-8-3-2-4-9-14)17(20)24(23-12)11-13-7-5-6-10-15(13)19/h2-10,21H,11H2,1H3,(H,22,25) |
| InChIKey | BAVWDFYDJBXMIA-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.26 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|