C25H23Cl2N5O2 — CID 29357963
5-chloro-1-[(2-chlorophenyl)methyl]-N'-(2,5-dimethyl-1-phenylpyrrole-3-carbonyl)-3-methylpyrazole-4-carbohydrazide (PubChem CID 29357963) has the molecular formula C25H23Cl2N5O2 and a molecular weight of 496.40 g/mol. Its IUPAC name is 5-chloro-1-[(2-chlorophenyl)methyl]-N'-(2,5-dimethyl-1-phenylpyrrole-3-carbonyl)-3-methylpyrazole-4-carbohydrazide.
| Compound Name | 5-chloro-1-[(2-chlorophenyl)methyl]-N'-(2,5-dimethyl-1-phenylpyrrole-3-carbonyl)-3-methylpyrazole-4-carbohydrazide |
|---|---|
| PubChem CID | 29357963 |
| Molecular Formula | C25H23Cl2N5O2 |
| Molecular Weight | 496.40 g/mol |
| Exact Mass | 495.12 |
| IUPAC Name | 5-chloro-1-[(2-chlorophenyl)methyl]-N'-(2,5-dimethyl-1-phenylpyrrole-3-carbonyl)-3-methylpyrazole-4-carbohydrazide |
| SMILES | Cc1nn(Cc2ccccc2Cl)c(Cl)c1C(=O)NNC(=O)c1cc(C)n(-c2ccccc2)c1C |
| InChI | InChI=1S/C25H23Cl2N5O2/c1-15-13-20(17(3)32(15)19-10-5-4-6-11-19)24(33)28-29-25(34)22-16(2)30-31(23(22)27)14-18-9-7-8-12-21(18)26/h4-13H,14H2,1-3H3,(H,28,33)(H,29,34) |
| InChIKey | BETSQKVPAAMYEB-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 80.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.40 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|