C21H20N6O2 — CID 86822848
N'-(2,5-dimethyl-1-phenylpyrrole-3-carbonyl)-2-methylpyrazolo[1,5-a]pyrimidine-3-carbohydrazide (PubChem CID 86822848) has the molecular formula C21H20N6O2 and a molecular weight of 388.43 g/mol. Its IUPAC name is N'-(2,5-dimethyl-1-phenylpyrrole-3-carbonyl)-2-methylpyrazolo[1,5-a]pyrimidine-3-carbohydrazide.
| Compound Name | N'-(2,5-dimethyl-1-phenylpyrrole-3-carbonyl)-2-methylpyrazolo[1,5-a]pyrimidine-3-carbohydrazide |
|---|---|
| PubChem CID | 86822848 |
| Molecular Formula | C21H20N6O2 |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | N'-(2,5-dimethyl-1-phenylpyrrole-3-carbonyl)-2-methylpyrazolo[1,5-a]pyrimidine-3-carbohydrazide |
| SMILES | Cc1nn2cccnc2c1C(=O)NNC(=O)c1cc(C)n(-c2ccccc2)c1C |
| InChI | InChI=1S/C21H20N6O2/c1-13-12-17(15(3)27(13)16-8-5-4-6-9-16)20(28)23-24-21(29)18-14(2)25-26-11-7-10-22-19(18)26/h4-12H,1-3H3,(H,23,28)(H,24,29) |
| InChIKey | XWKBDPPVKNZVFC-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 93.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|