C23H25N3O4 — CID 30475355
N'-(3,5-dimethoxy-4-methylbenzoyl)-2,5-dimethyl-1-phenylpyrrole-3-carbohydrazide (PubChem CID 30475355) has the molecular formula C23H25N3O4 and a molecular weight of 407.47 g/mol. Its IUPAC name is N'-(3,5-dimethoxy-4-methylbenzoyl)-2,5-dimethyl-1-phenylpyrrole-3-carbohydrazide.
| Compound Name | N'-(3,5-dimethoxy-4-methylbenzoyl)-2,5-dimethyl-1-phenylpyrrole-3-carbohydrazide |
|---|---|
| PubChem CID | 30475355 |
| Molecular Formula | C23H25N3O4 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | N'-(3,5-dimethoxy-4-methylbenzoyl)-2,5-dimethyl-1-phenylpyrrole-3-carbohydrazide |
| SMILES | COc1cc(C(=O)NNC(=O)c2cc(C)n(-c3ccccc3)c2C)cc(OC)c1C |
| InChI | InChI=1S/C23H25N3O4/c1-14-11-19(16(3)26(14)18-9-7-6-8-10-18)23(28)25-24-22(27)17-12-20(29-4)15(2)21(13-17)30-5/h6-13H,1-5H3,(H,24,27)(H,25,28) |
| InChIKey | UIWCPSFMUWJVFC-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|