C22H21N3O4 — CID 40714036
methyl 4-[[(2,5-dimethyl-1-phenylpyrrole-3-carbonyl)amino]carbamoyl]benzoate (PubChem CID 40714036) has the molecular formula C22H21N3O4 and a molecular weight of 391.43 g/mol. Its IUPAC name is methyl 4-[[(2,5-dimethyl-1-phenylpyrrole-3-carbonyl)amino]carbamoyl]benzoate.
| Compound Name | methyl 4-[[(2,5-dimethyl-1-phenylpyrrole-3-carbonyl)amino]carbamoyl]benzoate |
|---|---|
| PubChem CID | 40714036 |
| Molecular Formula | C22H21N3O4 |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | methyl 4-[[(2,5-dimethyl-1-phenylpyrrole-3-carbonyl)amino]carbamoyl]benzoate |
| SMILES | COC(=O)c1ccc(C(=O)NNC(=O)c2cc(C)n(-c3ccccc3)c2C)cc1 |
| InChI | InChI=1S/C22H21N3O4/c1-14-13-19(15(2)25(14)18-7-5-4-6-8-18)21(27)24-23-20(26)16-9-11-17(12-10-16)22(28)29-3/h4-13H,1-3H3,(H,23,26)(H,24,27) |
| InChIKey | ZOWBYCPYNMTDBV-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 89.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|