About 4-[[(2,5-dimethyl-1-phenylpyrrole-3-carbonyl)amino]carbamoyl]benzamide
4-[[(2,5-dimethyl-1-phenylpyrrole-3-carbonyl)amino]carbamoyl]benzamide (PubChem CID 27683580) has the molecular formula C21H20N4O3
and a molecular weight of 376.42 g/mol. Its IUPAC name is 4-[[(2,5-dimethyl-1-phenylpyrrole-3-carbonyl)amino]carbamoyl]benzamide.
Molecular Properties
| Compound Name | 4-[[(2,5-dimethyl-1-phenylpyrrole-3-carbonyl)amino]carbamoyl]benzamide |
| PubChem CID | 27683580 |
| Molecular Formula | C21H20N4O3 |
| Molecular Weight | 376.42 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | 4-[[(2,5-dimethyl-1-phenylpyrrole-3-carbonyl)amino]carbamoyl]benzamide |
| SMILES | Cc1cc(C(=O)NNC(=O)c2ccc(C(N)=O)cc2)c(C)n1-c1ccccc1 |
| InChI | InChI=1S/C21H20N4O3/c1-13-12-18(14(2)25(13)17-6-4-3-5-7-17)21(28)24-23-20(27)16-10-8-15(9-11-16)19(22)26/h3-12H,1-2H3,(H2,22,26)(H,23,27)(H,24,28) |
| InChIKey | HHRMLZZFYCRXPA-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 106.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.42 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[[(2,5-dimethyl-1-phenylpyrrole-3-carbonyl)amino]carbamoyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[(2,5-dimethyl-1-phenylpyrrole-3-carbonyl)amino]carbamoyl]benzamide?
The IUPAC name of 4-[[(2,5-dimethyl-1-phenylpyrrole-3-carbonyl)amino]carbamoyl]benzamide (CID 27683580) is 4-[[(2,5-dimethyl-1-phenylpyrrole-3-carbonyl)amino]carbamoyl]benzamide.
What is the SMILES notation for 4-[[(2,5-dimethyl-1-phenylpyrrole-3-carbonyl)amino]carbamoyl]benzamide?
The canonical SMILES for 4-[[(2,5-dimethyl-1-phenylpyrrole-3-carbonyl)amino]carbamoyl]benzamide is Cc1cc(C(=O)NNC(=O)c2ccc(C(N)=O)cc2)c(C)n1-c1ccccc1.
What is the InChIKey of 4-[[(2,5-dimethyl-1-phenylpyrrole-3-carbonyl)amino]carbamoyl]benzamide?
The InChIKey is HHRMLZZFYCRXPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20N4O3/c1-13-12-18(14(2)25(13)17-6-4-3-5-7-17)21(28)24-23-20(27)16-10-8-15(9-11-16)19(22)26/h3-12H,1-2H3,(H2,22,26)(H,23,27)(H,24,28).
What are the key properties of 4-[[(2,5-dimethyl-1-phenylpyrrole-3-carbonyl)amino]carbamoyl]benzamide?
4-[[(2,5-dimethyl-1-phenylpyrrole-3-carbonyl)amino]carbamoyl]benzamide has a molecular weight of 376.42 g/mol, XLogP of 2.27, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[(2,5-dimethyl-1-phenylpyrrole-3-carbonyl)amino]carbamoyl]benzamide is sourced from PubChem (CID 27683580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).