C18H17N5O3 — CID 2403352
N'-(2,5-dimethyl-1-phenylpyrrole-3-carbonyl)-6-oxo-1H-pyridazine-3-carbohydrazide (PubChem CID 2403352) has the molecular formula C18H17N5O3 and a molecular weight of 351.37 g/mol. Its IUPAC name is N'-(2,5-dimethyl-1-phenylpyrrole-3-carbonyl)-6-oxo-1H-pyridazine-3-carbohydrazide.
| Compound Name | N'-(2,5-dimethyl-1-phenylpyrrole-3-carbonyl)-6-oxo-1H-pyridazine-3-carbohydrazide |
|---|---|
| PubChem CID | 2403352 |
| Molecular Formula | C18H17N5O3 |
| Molecular Weight | 351.37 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | N'-(2,5-dimethyl-1-phenylpyrrole-3-carbonyl)-6-oxo-1H-pyridazine-3-carbohydrazide |
| SMILES | Cc1cc(C(=O)NNC(=O)c2ccc(=O)[nH]n2)c(C)n1-c1ccccc1 |
| InChI | InChI=1S/C18H17N5O3/c1-11-10-14(12(2)23(11)13-6-4-3-5-7-13)17(25)21-22-18(26)15-8-9-16(24)20-19-15/h3-10H,1-2H3,(H,20,24)(H,21,25)(H,22,26) |
| InChIKey | WKHNLHBLUYYGSI-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 108.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.37 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|