C12H9BrN4O3 — CID 29264522
N'-(2-bromobenzoyl)-6-oxo-1H-pyridazine-3-carbohydrazide (PubChem CID 29264522) has the molecular formula C12H9BrN4O3 and a molecular weight of 337.13 g/mol. Its IUPAC name is N'-(2-bromobenzoyl)-6-oxo-1H-pyridazine-3-carbohydrazide.
| Compound Name | N'-(2-bromobenzoyl)-6-oxo-1H-pyridazine-3-carbohydrazide |
|---|---|
| PubChem CID | 29264522 |
| Molecular Formula | C12H9BrN4O3 |
| Molecular Weight | 337.13 g/mol |
| Exact Mass | 335.99 |
| IUPAC Name | N'-(2-bromobenzoyl)-6-oxo-1H-pyridazine-3-carbohydrazide |
| SMILES | O=C(NNC(=O)c1ccccc1Br)c1ccc(=O)[nH]n1 |
| InChI | InChI=1S/C12H9BrN4O3/c13-8-4-2-1-3-7(8)11(19)16-17-12(20)9-5-6-10(18)15-14-9/h1-6H,(H,15,18)(H,16,19)(H,17,20) |
| InChIKey | BRDPFVDUOBHRDE-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 103.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.13 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|