C9H10BrN3O2 — CID 47140225
1-[(2-bromobenzoyl)amino]-3-methylurea (PubChem CID 47140225) has the molecular formula C9H10BrN3O2 and a molecular weight of 272.10 g/mol. Its IUPAC name is 1-[(2-bromobenzoyl)amino]-3-methylurea.
| Compound Name | 1-[(2-bromobenzoyl)amino]-3-methylurea |
|---|---|
| PubChem CID | 47140225 |
| Molecular Formula | C9H10BrN3O2 |
| Molecular Weight | 272.10 g/mol |
| Exact Mass | 271.00 |
| IUPAC Name | 1-[(2-bromobenzoyl)amino]-3-methylurea |
| SMILES | CNC(=O)NNC(=O)c1ccccc1Br |
| InChI | InChI=1S/C9H10BrN3O2/c1-11-9(15)13-12-8(14)6-4-2-3-5-7(6)10/h2-5H,1H3,(H,12,14)(H2,11,13,15) |
| InChIKey | NLLIHKZRPUWMKN-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.10 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|