C12H7BrCl2N2O2S — CID 27672192
N'-(2-bromobenzoyl)-2,5-dichlorothiophene-3-carbohydrazide (PubChem CID 27672192) has the molecular formula C12H7BrCl2N2O2S and a molecular weight of 394.08 g/mol. Its IUPAC name is N'-(2-bromobenzoyl)-2,5-dichlorothiophene-3-carbohydrazide.
| Compound Name | N'-(2-bromobenzoyl)-2,5-dichlorothiophene-3-carbohydrazide |
|---|---|
| PubChem CID | 27672192 |
| Molecular Formula | C12H7BrCl2N2O2S |
| Molecular Weight | 394.08 g/mol |
| Exact Mass | 391.88 |
| IUPAC Name | N'-(2-bromobenzoyl)-2,5-dichlorothiophene-3-carbohydrazide |
| SMILES | O=C(NNC(=O)c1cc(Cl)sc1Cl)c1ccccc1Br |
| InChI | InChI=1S/C12H7BrCl2N2O2S/c13-8-4-2-1-3-6(8)11(18)16-17-12(19)7-5-9(14)20-10(7)15/h1-5H,(H,16,18)(H,17,19) |
| InChIKey | WMKGHZJWAJHMGX-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.08 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|