C20H17F2N3O2 — CID 40673432
N'-(3,4-difluorobenzoyl)-2,5-dimethyl-1-phenylpyrrole-3-carbohydrazide (PubChem CID 40673432) has the molecular formula C20H17F2N3O2 and a molecular weight of 369.37 g/mol. Its IUPAC name is N'-(3,4-difluorobenzoyl)-2,5-dimethyl-1-phenylpyrrole-3-carbohydrazide.
| Compound Name | N'-(3,4-difluorobenzoyl)-2,5-dimethyl-1-phenylpyrrole-3-carbohydrazide |
|---|---|
| PubChem CID | 40673432 |
| Molecular Formula | C20H17F2N3O2 |
| Molecular Weight | 369.37 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | N'-(3,4-difluorobenzoyl)-2,5-dimethyl-1-phenylpyrrole-3-carbohydrazide |
| SMILES | Cc1cc(C(=O)NNC(=O)c2ccc(F)c(F)c2)c(C)n1-c1ccccc1 |
| InChI | InChI=1S/C20H17F2N3O2/c1-12-10-16(13(2)25(12)15-6-4-3-5-7-15)20(27)24-23-19(26)14-8-9-17(21)18(22)11-14/h3-11H,1-2H3,(H,23,26)(H,24,27) |
| InChIKey | DOVBRYGHRHJGMV-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.37 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|