C22H21F2N3O2 — CID 55616762
N'-[3-(3,4-difluorophenyl)propanoyl]-2,5-dimethyl-1-phenylpyrrole-3-carbohydrazide (PubChem CID 55616762) has the molecular formula C22H21F2N3O2 and a molecular weight of 397.43 g/mol. Its IUPAC name is N'-[3-(3,4-difluorophenyl)propanoyl]-2,5-dimethyl-1-phenylpyrrole-3-carbohydrazide.
| Compound Name | N'-[3-(3,4-difluorophenyl)propanoyl]-2,5-dimethyl-1-phenylpyrrole-3-carbohydrazide |
|---|---|
| PubChem CID | 55616762 |
| Molecular Formula | C22H21F2N3O2 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | N'-[3-(3,4-difluorophenyl)propanoyl]-2,5-dimethyl-1-phenylpyrrole-3-carbohydrazide |
| SMILES | Cc1cc(C(=O)NNC(=O)CCc2ccc(F)c(F)c2)c(C)n1-c1ccccc1 |
| InChI | InChI=1S/C22H21F2N3O2/c1-14-12-18(15(2)27(14)17-6-4-3-5-7-17)22(29)26-25-21(28)11-9-16-8-10-19(23)20(24)13-16/h3-8,10,12-13H,9,11H2,1-2H3,(H,25,28)(H,26,29) |
| InChIKey | IBVKQGLOPVRVNY-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|