C23H23FN4O4 — CID 24540815
N-[2-[2-[1-(4-fluorophenyl)-2,5-dimethylpyrrole-3-carbonyl]hydrazinyl]-2-oxoethyl]-2-phenoxyacetamide (PubChem CID 24540815) has the molecular formula C23H23FN4O4 and a molecular weight of 438.46 g/mol. Its IUPAC name is N-[2-[2-[1-(4-fluorophenyl)-2,5-dimethylpyrrole-3-carbonyl]hydrazinyl]-2-oxoethyl]-2-phenoxyacetamide.
| Compound Name | N-[2-[2-[1-(4-fluorophenyl)-2,5-dimethylpyrrole-3-carbonyl]hydrazinyl]-2-oxoethyl]-2-phenoxyacetamide |
|---|---|
| PubChem CID | 24540815 |
| Molecular Formula | C23H23FN4O4 |
| Molecular Weight | 438.46 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | N-[2-[2-[1-(4-fluorophenyl)-2,5-dimethylpyrrole-3-carbonyl]hydrazinyl]-2-oxoethyl]-2-phenoxyacetamide |
| SMILES | Cc1cc(C(=O)NNC(=O)CNC(=O)COc2ccccc2)c(C)n1-c1ccc(F)cc1 |
| InChI | InChI=1S/C23H23FN4O4/c1-15-12-20(16(2)28(15)18-10-8-17(24)9-11-18)23(31)27-26-21(29)13-25-22(30)14-32-19-6-4-3-5-7-19/h3-12H,13-14H2,1-2H3,(H,25,30)(H,26,29)(H,27,31) |
| InChIKey | WJKBJIYXCIOTDC-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 101.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.46 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|