C22H23N3O2 — CID 40714000
2,5-dimethyl-1-phenyl-N'-(3-phenylpropanoyl)pyrrole-3-carbohydrazide (PubChem CID 40714000) has the molecular formula C22H23N3O2 and a molecular weight of 361.44 g/mol. Its IUPAC name is 2,5-dimethyl-1-phenyl-N'-(3-phenylpropanoyl)pyrrole-3-carbohydrazide.
| Compound Name | 2,5-dimethyl-1-phenyl-N'-(3-phenylpropanoyl)pyrrole-3-carbohydrazide |
|---|---|
| PubChem CID | 40714000 |
| Molecular Formula | C22H23N3O2 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | 2,5-dimethyl-1-phenyl-N'-(3-phenylpropanoyl)pyrrole-3-carbohydrazide |
| SMILES | Cc1cc(C(=O)NNC(=O)CCc2ccccc2)c(C)n1-c1ccccc1 |
| InChI | InChI=1S/C22H23N3O2/c1-16-15-20(17(2)25(16)19-11-7-4-8-12-19)22(27)24-23-21(26)14-13-18-9-5-3-6-10-18/h3-12,15H,13-14H2,1-2H3,(H,23,26)(H,24,27) |
| InChIKey | YIKGPIBOFQRLMQ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|