C23H26N2O — CID 110654758
1-(2,5-dimethyl-1-phenylpyrrol-3-yl)-2-(3-phenylpropylamino)ethanone (PubChem CID 110654758) has the molecular formula C23H26N2O and a molecular weight of 346.47 g/mol. Its IUPAC name is 1-(2,5-dimethyl-1-phenylpyrrol-3-yl)-2-(3-phenylpropylamino)ethanone.
| Compound Name | 1-(2,5-dimethyl-1-phenylpyrrol-3-yl)-2-(3-phenylpropylamino)ethanone |
|---|---|
| PubChem CID | 110654758 |
| Molecular Formula | C23H26N2O |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | 1-(2,5-dimethyl-1-phenylpyrrol-3-yl)-2-(3-phenylpropylamino)ethanone |
| SMILES | Cc1cc(C(=O)CNCCCc2ccccc2)c(C)n1-c1ccccc1 |
| InChI | InChI=1S/C23H26N2O/c1-18-16-22(19(2)25(18)21-13-7-4-8-14-21)23(26)17-24-15-9-12-20-10-5-3-6-11-20/h3-8,10-11,13-14,16,24H,9,12,15,17H2,1-2H3 |
| InChIKey | VUDRWHLJWYHQEB-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|