C22H30N2O — CID 110655097
1-(1-cyclohexyl-2,5-dimethylpyrrol-3-yl)-2-(2-phenylethylamino)ethanone (PubChem CID 110655097) has the molecular formula C22H30N2O and a molecular weight of 338.50 g/mol. Its IUPAC name is 1-(1-cyclohexyl-2,5-dimethylpyrrol-3-yl)-2-(2-phenylethylamino)ethanone.
| Compound Name | 1-(1-cyclohexyl-2,5-dimethylpyrrol-3-yl)-2-(2-phenylethylamino)ethanone |
|---|---|
| PubChem CID | 110655097 |
| Molecular Formula | C22H30N2O |
| Molecular Weight | 338.50 g/mol |
| Exact Mass | 338.24 |
| IUPAC Name | 1-(1-cyclohexyl-2,5-dimethylpyrrol-3-yl)-2-(2-phenylethylamino)ethanone |
| SMILES | Cc1cc(C(=O)CNCCc2ccccc2)c(C)n1C1CCCCC1 |
| InChI | InChI=1S/C22H30N2O/c1-17-15-21(18(2)24(17)20-11-7-4-8-12-20)22(25)16-23-14-13-19-9-5-3-6-10-19/h3,5-6,9-10,15,20,23H,4,7-8,11-14,16H2,1-2H3 |
| InChIKey | XAXVJEBGHFHLMT-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.50 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|