C20H25NO2 — CID 110656364
1-(1-cyclohexyl-2,5-dimethylpyrrol-3-yl)-2-phenoxyethanone (PubChem CID 110656364) has the molecular formula C20H25NO2 and a molecular weight of 311.43 g/mol. Its IUPAC name is 1-(1-cyclohexyl-2,5-dimethylpyrrol-3-yl)-2-phenoxyethanone.
| Compound Name | 1-(1-cyclohexyl-2,5-dimethylpyrrol-3-yl)-2-phenoxyethanone |
|---|---|
| PubChem CID | 110656364 |
| Molecular Formula | C20H25NO2 |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.19 |
| IUPAC Name | 1-(1-cyclohexyl-2,5-dimethylpyrrol-3-yl)-2-phenoxyethanone |
| SMILES | Cc1cc(C(=O)COc2ccccc2)c(C)n1C1CCCCC1 |
| InChI | InChI=1S/C20H25NO2/c1-15-13-19(16(2)21(15)17-9-5-3-6-10-17)20(22)14-23-18-11-7-4-8-12-18/h4,7-8,11-13,17H,3,5-6,9-10,14H2,1-2H3 |
| InChIKey | RXTKSDUSNXVKDN-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |