C20H19ClN2O — CID 110654783
2-(4-chloroanilino)-1-(2,5-dimethyl-1-phenylpyrrol-3-yl)ethanone (PubChem CID 110654783) has the molecular formula C20H19ClN2O and a molecular weight of 338.84 g/mol. Its IUPAC name is 2-(4-chloroanilino)-1-(2,5-dimethyl-1-phenylpyrrol-3-yl)ethanone.
| Compound Name | 2-(4-chloroanilino)-1-(2,5-dimethyl-1-phenylpyrrol-3-yl)ethanone |
|---|---|
| PubChem CID | 110654783 |
| Molecular Formula | C20H19ClN2O |
| Molecular Weight | 338.84 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | 2-(4-chloroanilino)-1-(2,5-dimethyl-1-phenylpyrrol-3-yl)ethanone |
| SMILES | Cc1cc(C(=O)CNc2ccc(Cl)cc2)c(C)n1-c1ccccc1 |
| InChI | InChI=1S/C20H19ClN2O/c1-14-12-19(15(2)23(14)18-6-4-3-5-7-18)20(24)13-22-17-10-8-16(21)9-11-17/h3-12,22H,13H2,1-2H3 |
| InChIKey | YPAFWLRBPNPYKZ-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.84 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|