C23H24N2O3 — CID 110654818
ethyl 4-[[2-(2,5-dimethyl-1-phenylpyrrol-3-yl)-2-oxoethyl]amino]benzoate (PubChem CID 110654818) has the molecular formula C23H24N2O3 and a molecular weight of 376.46 g/mol. Its IUPAC name is ethyl 4-[[2-(2,5-dimethyl-1-phenylpyrrol-3-yl)-2-oxoethyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-(2,5-dimethyl-1-phenylpyrrol-3-yl)-2-oxoethyl]amino]benzoate |
|---|---|
| PubChem CID | 110654818 |
| Molecular Formula | C23H24N2O3 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | ethyl 4-[[2-(2,5-dimethyl-1-phenylpyrrol-3-yl)-2-oxoethyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NCC(=O)c2cc(C)n(-c3ccccc3)c2C)cc1 |
| InChI | InChI=1S/C23H24N2O3/c1-4-28-23(27)18-10-12-19(13-11-18)24-15-22(26)21-14-16(2)25(17(21)3)20-8-6-5-7-9-20/h5-14,24H,4,15H2,1-3H3 |
| InChIKey | VWCSBYIKABVJTG-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|