C21H19N3O — CID 110654825
3-[[2-(2,5-dimethyl-1-phenylpyrrol-3-yl)-2-oxoethyl]amino]benzonitrile (PubChem CID 110654825) has the molecular formula C21H19N3O and a molecular weight of 329.40 g/mol. Its IUPAC name is 3-[[2-(2,5-dimethyl-1-phenylpyrrol-3-yl)-2-oxoethyl]amino]benzonitrile.
| Compound Name | 3-[[2-(2,5-dimethyl-1-phenylpyrrol-3-yl)-2-oxoethyl]amino]benzonitrile |
|---|---|
| PubChem CID | 110654825 |
| Molecular Formula | C21H19N3O |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.15 |
| IUPAC Name | 3-[[2-(2,5-dimethyl-1-phenylpyrrol-3-yl)-2-oxoethyl]amino]benzonitrile |
| SMILES | Cc1cc(C(=O)CNc2cccc(C#N)c2)c(C)n1-c1ccccc1 |
| InChI | InChI=1S/C21H19N3O/c1-15-11-20(16(2)24(15)19-9-4-3-5-10-19)21(25)14-23-18-8-6-7-17(12-18)13-22/h3-12,23H,14H2,1-2H3 |
| InChIKey | KFJKQVORFNCKJP-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 57.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|