C19H22N2O — CID 156523104
4-[3-(3,3-dimethylbutanoyl)-2,5-dimethylpyrrol-1-yl]benzonitrile (PubChem CID 156523104) has the molecular formula C19H22N2O and a molecular weight of 294.40 g/mol. Its IUPAC name is 4-[3-(3,3-dimethylbutanoyl)-2,5-dimethylpyrrol-1-yl]benzonitrile.
| Compound Name | 4-[3-(3,3-dimethylbutanoyl)-2,5-dimethylpyrrol-1-yl]benzonitrile |
|---|---|
| PubChem CID | 156523104 |
| Molecular Formula | C19H22N2O |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | 4-[3-(3,3-dimethylbutanoyl)-2,5-dimethylpyrrol-1-yl]benzonitrile |
| SMILES | Cc1cc(C(=O)CC(C)(C)C)c(C)n1-c1ccc(C#N)cc1 |
| InChI | InChI=1S/C19H22N2O/c1-13-10-17(18(22)11-19(3,4)5)14(2)21(13)16-8-6-15(12-20)7-9-16/h6-10H,11H2,1-5H3 |
| InChIKey | UAVIWVWMEROQHY-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 45.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|