C15H15N3O3S — CID 146154363
1-(4-cyanophenyl)-2,5-dimethyl-N-methylsulfonylpyrrole-3-carboxamide (PubChem CID 146154363) has the molecular formula C15H15N3O3S and a molecular weight of 317.37 g/mol. Its IUPAC name is 1-(4-cyanophenyl)-2,5-dimethyl-N-methylsulfonylpyrrole-3-carboxamide.
| Compound Name | 1-(4-cyanophenyl)-2,5-dimethyl-N-methylsulfonylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 146154363 |
| Molecular Formula | C15H15N3O3S |
| Molecular Weight | 317.37 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | 1-(4-cyanophenyl)-2,5-dimethyl-N-methylsulfonylpyrrole-3-carboxamide |
| SMILES | Cc1cc(C(=O)NS(C)(=O)=O)c(C)n1-c1ccc(C#N)cc1 |
| InChI | InChI=1S/C15H15N3O3S/c1-10-8-14(15(19)17-22(3,20)21)11(2)18(10)13-6-4-12(9-16)5-7-13/h4-8H,1-3H3,(H,17,19) |
| InChIKey | WDYHYVWBJXHVJV-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 91.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.37 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|