About ethane;4-(2,3,5-trimethylpyrrol-1-yl)benzonitrile
ethane;4-(2,3,5-trimethylpyrrol-1-yl)benzonitrile (PubChem CID 153386821) has the molecular formula C16H20N2
and a molecular weight of 240.35 g/mol. Its IUPAC name is ethane;4-(2,3,5-trimethylpyrrol-1-yl)benzonitrile.
Molecular Properties
| Compound Name | ethane;4-(2,3,5-trimethylpyrrol-1-yl)benzonitrile |
| PubChem CID | 153386821 |
| Molecular Formula | C16H20N2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.16 |
| IUPAC Name | ethane;4-(2,3,5-trimethylpyrrol-1-yl)benzonitrile |
| SMILES | CC.Cc1cc(C)n(-c2ccc(C#N)cc2)c1C |
| InChI | InChI=1S/C14H14N2.C2H6/c1-10-8-11(2)16(12(10)3)14-6-4-13(9-15)5-7-14;1-2/h4-8H,1-3H3;1-2H3 |
| InChIKey | JCUPSLXKJWTSSX-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 28.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|
Analyze ethane;4-(2,3,5-trimethylpyrrol-1-yl)benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-(2,3,5-trimethylpyrrol-1-yl)benzonitrile?
The IUPAC name of ethane;4-(2,3,5-trimethylpyrrol-1-yl)benzonitrile (CID 153386821) is ethane;4-(2,3,5-trimethylpyrrol-1-yl)benzonitrile.
What is the SMILES notation for ethane;4-(2,3,5-trimethylpyrrol-1-yl)benzonitrile?
The canonical SMILES for ethane;4-(2,3,5-trimethylpyrrol-1-yl)benzonitrile is CC.Cc1cc(C)n(-c2ccc(C#N)cc2)c1C.
What is the InChIKey of ethane;4-(2,3,5-trimethylpyrrol-1-yl)benzonitrile?
The InChIKey is JCUPSLXKJWTSSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14N2.C2H6/c1-10-8-11(2)16(12(10)3)14-6-4-13(9-15)5-7-14;1-2/h4-8H,1-3H3;1-2H3.
What are the key properties of ethane;4-(2,3,5-trimethylpyrrol-1-yl)benzonitrile?
ethane;4-(2,3,5-trimethylpyrrol-1-yl)benzonitrile has a molecular weight of 240.35 g/mol, XLogP of 4.30, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-(2,3,5-trimethylpyrrol-1-yl)benzonitrile is sourced from PubChem (CID 153386821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).